giovannarocha9 giovannarocha9

07-12-2017
Mathematics

contestada

explain why you can or cannot figure out the shape of a tank if you only know how many gallons it holds

Respuesta :

shawnkat shawnkat

07-12-2017

You certainly cannot. This is because you can really only determine size from how many gallons it holds, and shape can differ as long as it can hold the amount needed. Hope this helps.

Answer Link

Otras preguntas

Write an equation for the proportional relationship shown in the table. The table has two rows and three columns. The first row is labeled x, and the second row

Find the volume of a cone that has a radius of 3 inches and the height of 4 inches

Paráfrasis del modelo de investigación cuantitativa

Find the other endpoint of the line segment with the given endpoint and midpoint. 4) Endpoint: (-9, 9), midpoint: (2,5)

10. In th B D E In the figure, AD = BD and AEB = ADB = 90°, show that CD = HD.

DO NOT USE THE BRAINLY AI TO ANSWER THIS, ITS WRONGGrayson owns a food truck that sells tacos and burritos. He only has enough supplies to make 110 tacos or bur

Subject: Write suitable slogans on the placards and caption the image.

Is the following statement True or False? An experimental research design involves a nonrandomized controlled trial.

3 C2H3O2H+Al(OH)3-Al(C2H3O2)3+H2O Determine the mass of aluminum acetated that can be made if this reaction with 125 grams of acetic acid and 275 gram of alumin

Subject: Write suitable slogans on the placards and caption the image.