KielieCooper KielieCooper

07-11-2022
Mathematics

contestada

tan(x+pie) + sin(x+pie) + sin (x-pie) = 0

Respuesta :

emmymaster3 emmymaster3

07-11-2022

Answer:Use the identity: sin(A+B) = sin(A)cos(B)+cos(A)sin(B) Substitute x for A and pi for B: sin(x+pi) = sin(x)cos(pi)+cos(x)sin(pi) The second term disappears, ...

Step-by-step explanation:

Answer Link

Otras preguntas

15 POINTS! What are some differences and similarities between Electromagnetic and Mechanical waves?

How does the text structure support the authors purpose?

Why are the king and the duke forced to hatch an evil plot as they whisper together in the wigwam on the raft?

Which expression has a value of 36 when x=4 and y=7 A. 2xy B. 2x+4y C. 6y-x D. 12x-2y

Select the correct pronoun. _____ all coming to our house after the game. There They're Their

what does mass culture mean in social studies?

In performing any laboratory experiment, what is the first step performed out of the following choices? A) collect data B) analyze data C) publish results D)

Which of the following statements is FALSE? a. Etymology is the study of word origins. b. Etymology looks at the earliest known use of a word. c. Etymology look

the measure of two complementary angles is in the ratio of 1:5. What are the degree measures of the two angles? Show work please!

marsha jogged 7.8 miles. erica jogged 0.5 times as far. how far did erica jog?