yaniselleaquin yaniselleaquin

08-12-2016
Mathematics

contestada

solve the following equation for x : 6(4x+5) = 3(x+8)+3

Respuesta :

Nathan0818 Nathan0818

08-12-2016

the answer to the following equation for x is x=-1/7

Answer Link

robinnate2310 robinnate2310

08-12-2016

Your answer is going to be -1/7

Answer Link

Otras preguntas

Law of sines: sin(A)/a=sin(B)/b=sin(C)/c How many distinct

math help please will mark brainliest

how many moles are in 2.41 × 10^24 formula units of RbNo3

What is the coefficient of x101y99 in the expansion of (2x − 3y)200?

How do you solve for the x?

Lighting is not really a large concern for most wedding photographers. Select one: True False

Why are carbon dioxide concentrations expected to increase? A. Carbon dioxide concentrations are expected to increase, because fossil fuel burning is expected t

Should You Work During the School Year? Who is the intended audience for this passage? College graduates Senior citizens High school students Foreign exchange s

A DNA molecule has the sequence GCATCCGA. What is the mRNA sequence resulting for this DNA code ? A. CCTAGGCT B. CGTAGGCT C. CGUAGGCU D. GCATCCGA

Which is a solution for the equation log (2x-1) + log 5=1