davedimanchehaiti255 davedimanchehaiti255

10-08-2020
Mathematics

contestada

Graph the function f(x) = 18(0.8)

Respuesta :

Аноним Аноним

10-08-2020

[tex]f(x)=18(0.8)=14.4[/tex]

is a constant function, so it will be a straight line parallel to x axis and passing through y axis at $14.4$

Answer Link

Otras preguntas

PLEASE HELP!!!! 1. Il est nécessaire... A. tu étudies. B. tu étudier. C. d'étudier. 2. Je doute que les profs.... A. sont sympas. B. être sympas. C. soient symp

A new game is being constructed where the game board is going to have 8 rows with 10 spaces in each row. What is the smallest game board that can be made? A. 16

simplify the expression using sum or difference identities cos(12)cos(-3)-sin(12)sin(-3)

what is the american dream project ?

To find the pka of x-281, you prepare a 0.089 m test solution of x-281 at 25.0 ∘c. the ph of the solution is determined to be 3.00. what is the pka of x-281?

What is the difference between mitosis and cell division?

Was the second new deal better than the first new deal? Explain the reasoning.

what type of energy from the movement or flow of electrons? mechanical energy potential energy chemical energy electrical energy

at what rate percent per year will a sum of money double itself in 15 years

What is the mass in grams of 2.48x10^22 atoms of oxygen?